About N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine
N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine (PubChem CID 58378800) has the molecular formula C22H21F2NO2S
and a molecular weight of 401.48 g/mol. Its IUPAC name is N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine |
| PubChem CID | 58378800 |
| Molecular Formula | C22H21F2NO2S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C22H21F2NO2S/c1-2-25-14-16-4-3-5-17(12-16)15-28(26,27)20-9-6-18(7-10-20)21-11-8-19(23)13-22(21)24/h3-13,25H,2,14-15H2,1H3 |
| InChIKey | LAUYEYOTHQMPQD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine?
The IUPAC name of N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine (CID 58378800) is N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine.
What is the SMILES notation for N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine?
The canonical SMILES for N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine is CCNCc1cccc(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1.
What is the InChIKey of N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine?
The InChIKey is LAUYEYOTHQMPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2NO2S/c1-2-25-14-16-4-3-5-17(12-16)15-28(26,27)20-9-6-18(7-10-20)21-11-8-19(23)13-22(21)24/h3-13,25H,2,14-15H2,1H3.
What are the key properties of N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine?
N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine has a molecular weight of 401.48 g/mol, XLogP of 4.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]methyl]ethanamine is sourced from PubChem (CID 58378800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).