C27H25ClN4O — CID 58378947
2-(4-chlorophenyl)-1-[(3S)-3-methyl-4-(4-phenylphthalazin-1-yl)piperazin-1-yl]ethanone (PubChem CID 58378947) has the molecular formula C27H25ClN4O and a molecular weight of 456.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[(3S)-3-methyl-4-(4-phenylphthalazin-1-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[(3S)-3-methyl-4-(4-phenylphthalazin-1-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58378947 |
| Molecular Formula | C27H25ClN4O |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[(3S)-3-methyl-4-(4-phenylphthalazin-1-yl)piperazin-1-yl]ethanone |
| SMILES | C[C@H]1CN(C(=O)Cc2ccc(Cl)cc2)CCN1c1nnc(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H25ClN4O/c1-19-18-31(25(33)17-20-11-13-22(28)14-12-20)15-16-32(19)27-24-10-6-5-9-23(24)26(29-30-27)21-7-3-2-4-8-21/h2-14,19H,15-18H2,1H3/t19-/m0/s1 |
| InChIKey | VBZVWJPLXOIFIW-IBGZPJMESA-N |
| XLogP | 5.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |