5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid

C6H3BrN2O2S — CID 58379309

IUPAC5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
SMILESO=C(O)c1nc2sccn2c1Br
InChIInChI=1S/C6H3BrN2O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,(H,10,11)
InChIKeyWONBUBRZVAEPCN-UHFFFAOYSA-N
MW247.07 g/mol
LogP1.86
Rot. Bonds1

About 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid

5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 58379309) has the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. Its IUPAC name is 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.

Molecular Properties

Compound Name5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
PubChem CID58379309
Molecular FormulaC6H3BrN2O2S
Molecular Weight247.07 g/mol
Exact Mass245.91
IUPAC Name5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
SMILESO=C(O)c1nc2sccn2c1Br
InChIInChI=1S/C6H3BrN2O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,(H,10,11)
InChIKeyWONBUBRZVAEPCN-UHFFFAOYSA-N
XLogP1.86
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.07
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The IUPAC name of 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CID 58379309) is 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
What is the SMILES notation for 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The canonical SMILES for 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is O=C(O)c1nc2sccn2c1Br.
What is the InChIKey of 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The InChIKey is WONBUBRZVAEPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,(H,10,11).
What are the key properties of 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid has a molecular weight of 247.07 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is sourced from PubChem (CID 58379309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).