C18H34O4Si — CID 58379412
methyl (1S,3aS,4S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate (PubChem CID 58379412) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is methyl (1S,3aS,4S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate.
| Compound Name | methyl (1S,3aS,4S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 58379412 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | methyl (1S,3aS,4S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](O)CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C18H34O4Si/c1-17(2,3)23(6,7)22-14-9-8-12-15(16(20)21-5)13(19)10-11-18(12,14)4/h12-15,19H,8-11H2,1-7H3/t12-,13-,14-,15-,18-/m0/s1 |
| InChIKey | MDXLGJHANBOERP-PQKJENKHSA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|