C25H39N3O4Si — CID 58379425
(1S,2R,5S,6S,12R,13R,14S,16R)-14-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-diene-12,13-diol (PubChem CID 58379425) has the molecular formula C25H39N3O4Si and a molecular weight of 473.69 g/mol. Its IUPAC name is (1S,2R,5S,6S,12R,13R,14S,16R)-14-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-diene-12,13-diol.
| Compound Name | (1S,2R,5S,6S,12R,13R,14S,16R)-14-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-diene-12,13-diol |
|---|---|
| PubChem CID | 58379425 |
| Molecular Formula | C25H39N3O4Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | (1S,2R,5S,6S,12R,13R,14S,16R)-14-azido-5-[tert-butyl(dimethyl)silyl]oxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-diene-12,13-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@H]2[C@]1(C)CC=C1C=C3[C@@H](O)[C@H](O)[C@@H](N=[N+]=[N-])C[C@]34CC[C@@]12O4 |
| InChI | InChI=1S/C25H39N3O4Si/c1-22(2,3)33(5,6)31-19-8-7-18-23(19,4)10-9-15-13-16-20(29)21(30)17(27-28-26)14-24(16)11-12-25(15,18)32-24/h9,13,17-21,29-30H,7-8,10-12,14H2,1-6H3/t17-,18+,19-,20+,21+,23-,24+,25+/m0/s1 |
| InChIKey | IOEKKDZTOLGDKD-GKNYKYQOSA-N |
| XLogP | 5.16 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|