C24H42OSi — CID 58379445
[(3S,3aS,8S,9aS,9bS)-3a,7-dimethyl-8-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58379445) has the molecular formula C24H42OSi and a molecular weight of 374.69 g/mol. Its IUPAC name is [(3S,3aS,8S,9aS,9bS)-3a,7-dimethyl-8-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,3aS,8S,9aS,9bS)-3a,7-dimethyl-8-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58379445 |
| Molecular Formula | C24H42OSi |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | [(3S,3aS,8S,9aS,9bS)-3a,7-dimethyl-8-propyl-1,2,3,4,8,9,9a,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCC[C@H]1C[C@@H]2C(=CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)C=C1C |
| InChI | InChI=1S/C24H42OSi/c1-9-10-18-16-20-19(15-17(18)2)13-14-24(6)21(20)11-12-22(24)25-26(7,8)23(3,4)5/h13,15,18,20-22H,9-12,14,16H2,1-8H3/t18-,20+,21-,22-,24-/m0/s1 |
| InChIKey | QARQMMCEZZRNLS-SODJYPQISA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|