C23H42O3Si — CID 58379451
[(1S,3aS,7aS)-5,7a-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 58379451) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(1S,3aS,7aS)-5,7a-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aS,7aS)-5,7a-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58379451 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(1S,3aS,7aS)-5,7a-dimethyl-4-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=C(CCC2(C)OCCO2)[C@@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C23H42O3Si/c1-17-11-13-22(5)19(18(17)12-14-23(6)24-15-16-25-23)9-10-20(22)26-27(7,8)21(2,3)4/h19-20H,9-16H2,1-8H3/t19-,20-,22-/m0/s1 |
| InChIKey | PTRKZTAAWNSURC-ONTIZHBOSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|