About 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one
1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one (PubChem CID 58379546) has the molecular formula C25H23N5O2
and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one |
| PubChem CID | 58379546 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one |
| SMILES | Cn1c(=O)n(C2CCC(O)CC2)c2c3nc(-c4cnc5ccccc5c4)ccc3ncc21 |
| InChI | InChI=1S/C25H23N5O2/c1-29-22-14-27-21-11-10-20(16-12-15-4-2-3-5-19(15)26-13-16)28-23(21)24(22)30(25(29)32)17-6-8-18(31)9-7-17/h2-5,10-14,17-18,31H,6-9H2,1H3 |
| InChIKey | LEDZNERMENQHCL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one?
The IUPAC name of 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one (CID 58379546) is 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one.
What is the SMILES notation for 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one?
The canonical SMILES for 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one is Cn1c(=O)n(C2CCC(O)CC2)c2c3nc(-c4cnc5ccccc5c4)ccc3ncc21.
What is the InChIKey of 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one?
The InChIKey is LEDZNERMENQHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N5O2/c1-29-22-14-27-21-11-10-20(16-12-15-4-2-3-5-19(15)26-13-16)28-23(21)24(22)30(25(29)32)17-6-8-18(31)9-7-17/h2-5,10-14,17-18,31H,6-9H2,1H3.
What are the key properties of 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one?
1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one has a molecular weight of 425.49 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxycyclohexyl)-3-methyl-8-quinolin-3-ylimidazo[4,5-c][1,5]naphthyridin-2-one is sourced from PubChem (CID 58379546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).