About 6-methyl-3-methylidene-1,2-dihydroindene
6-methyl-3-methylidene-1,2-dihydroindene (PubChem CID 58380222) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 6-methyl-3-methylidene-1,2-dihydroindene.
Molecular Properties
| Compound Name | 6-methyl-3-methylidene-1,2-dihydroindene |
| PubChem CID | 58380222 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 6-methyl-3-methylidene-1,2-dihydroindene |
| SMILES | C=C1CCc2cc(C)ccc21 |
| InChI | InChI=1S/C11H12/c1-8-3-6-11-9(2)4-5-10(11)7-8/h3,6-7H,2,4-5H2,1H3 |
| InChIKey | PHCCYGAMEVMEBZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-methyl-3-methylidene-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-methylidene-1,2-dihydroindene?
The IUPAC name of 6-methyl-3-methylidene-1,2-dihydroindene (CID 58380222) is 6-methyl-3-methylidene-1,2-dihydroindene.
What is the SMILES notation for 6-methyl-3-methylidene-1,2-dihydroindene?
The canonical SMILES for 6-methyl-3-methylidene-1,2-dihydroindene is C=C1CCc2cc(C)ccc21.
What is the InChIKey of 6-methyl-3-methylidene-1,2-dihydroindene?
The InChIKey is PHCCYGAMEVMEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-8-3-6-11-9(2)4-5-10(11)7-8/h3,6-7H,2,4-5H2,1H3.
What are the key properties of 6-methyl-3-methylidene-1,2-dihydroindene?
6-methyl-3-methylidene-1,2-dihydroindene has a molecular weight of 144.22 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-methylidene-1,2-dihydroindene is sourced from PubChem (CID 58380222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).