2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid

C10H10BrN3O3 — CID 58380641

IUPAC2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid
SMILESCCn1c(=O)n(CC(=O)O)c2cc(Br)cnc21
InChIInChI=1S/C10H10BrN3O3/c1-2-13-9-7(3-6(11)4-12-9)14(10(13)17)5-8(15)16/h3-4H,2,5H2,1H3,(H,15,16)
InChIKeyXJUQBAICWGHWFP-UHFFFAOYSA-N
MW300.11 g/mol
LogP1.07
Rot. Bonds3

About 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid

2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid (PubChem CID 58380641) has the molecular formula C10H10BrN3O3 and a molecular weight of 300.11 g/mol. Its IUPAC name is 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid
PubChem CID58380641
Molecular FormulaC10H10BrN3O3
Molecular Weight300.11 g/mol
Exact Mass298.99
IUPAC Name2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid
SMILESCCn1c(=O)n(CC(=O)O)c2cc(Br)cnc21
InChIInChI=1S/C10H10BrN3O3/c1-2-13-9-7(3-6(11)4-12-9)14(10(13)17)5-8(15)16/h3-4H,2,5H2,1H3,(H,15,16)
InChIKeyXJUQBAICWGHWFP-UHFFFAOYSA-N
XLogP1.07
TPSA77.12 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.11
LogP ≤ 51.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid?
The IUPAC name of 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid (CID 58380641) is 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid.
What is the SMILES notation for 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid?
The canonical SMILES for 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid is CCn1c(=O)n(CC(=O)O)c2cc(Br)cnc21.
What is the InChIKey of 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid?
The InChIKey is XJUQBAICWGHWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O3/c1-2-13-9-7(3-6(11)4-12-9)14(10(13)17)5-8(15)16/h3-4H,2,5H2,1H3,(H,15,16).
What are the key properties of 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid?
2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid has a molecular weight of 300.11 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-3-ethyl-2-oxoimidazo[4,5-b]pyridin-1-yl)acetic acid is sourced from PubChem (CID 58380641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).