About benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate
benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate (PubChem CID 58380830) has the molecular formula C24H35NO5
and a molecular weight of 417.55 g/mol. Its IUPAC name is benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate |
| PubChem CID | 58380830 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)C1(C2CCOCC2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C24H35NO5/c1-2-21(25-22(26)28-18-19-6-4-3-5-7-19)23(20-8-14-27-15-9-20)10-12-24(13-11-23)29-16-17-30-24/h3-7,20-21H,2,8-18H2,1H3,(H,25,26) |
| InChIKey | MLBNEHCDIKKGAL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate?
The IUPAC name of benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate (CID 58380830) is benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate.
What is the SMILES notation for benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate?
The canonical SMILES for benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate is CCC(NC(=O)OCc1ccccc1)C1(C2CCOCC2)CCC2(CC1)OCCO2.
What is the InChIKey of benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate?
The InChIKey is MLBNEHCDIKKGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NO5/c1-2-21(25-22(26)28-18-19-6-4-3-5-7-19)23(20-8-14-27-15-9-20)10-12-24(13-11-23)29-16-17-30-24/h3-7,20-21H,2,8-18H2,1H3,(H,25,26).
What are the key properties of benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate?
benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate has a molecular weight of 417.55 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[1-[8-(oxan-4-yl)-1,4-dioxaspiro[4.5]decan-8-yl]propyl]carbamate is sourced from PubChem (CID 58380830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).