About 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone
1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone (PubChem CID 58381098) has the molecular formula C26H20F2N2O2
and a molecular weight of 430.45 g/mol. Its IUPAC name is 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
| PubChem CID | 58381098 |
| Molecular Formula | C26H20F2N2O2 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-c1ccc2nc(C#Cc3ccc(OCC(C)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C26H20F2N2O2/c1-17(31)21-5-3-4-6-22(21)19-10-13-23-24(15-19)30-25(29-23)14-9-18-7-11-20(12-8-18)32-16-26(2,27)28/h3-8,10-13,15H,16H2,1-2H3,(H,29,30) |
| InChIKey | WHSFPPRDCXZVKD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone?
The IUPAC name of 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone (CID 58381098) is 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone.
What is the SMILES notation for 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone?
The canonical SMILES for 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone is CC(=O)c1ccccc1-c1ccc2nc(C#Cc3ccc(OCC(C)(F)F)cc3)[nH]c2c1.
What is the InChIKey of 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone?
The InChIKey is WHSFPPRDCXZVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F2N2O2/c1-17(31)21-5-3-4-6-22(21)19-10-13-23-24(15-19)30-25(29-23)14-9-18-7-11-20(12-8-18)32-16-26(2,27)28/h3-8,10-13,15H,16H2,1-2H3,(H,29,30).
What are the key properties of 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone?
1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone has a molecular weight of 430.45 g/mol, XLogP of 5.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-[2-[4-(2,2-difluoropropoxy)phenyl]ethynyl]-3H-benzimidazol-5-yl]phenyl]ethanone is sourced from PubChem (CID 58381098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).