About (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine
(3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine (PubChem CID 58381294) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine.
Molecular Properties
| Compound Name | (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine |
| PubChem CID | 58381294 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine |
| SMILES | CC1(N[C@@H]2CCOC[C@H]2N)CCCC1 |
| InChI | InChI=1S/C11H22N2O/c1-11(5-2-3-6-11)13-10-4-7-14-8-9(10)12/h9-10,13H,2-8,12H2,1H3/t9-,10-/m1/s1 |
| InChIKey | LNMAINKFAPXYIH-NXEZZACHSA-N |
| XLogP | 1.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine?
The IUPAC name of (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine (CID 58381294) is (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine.
What is the SMILES notation for (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine?
The canonical SMILES for (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine is CC1(N[C@@H]2CCOC[C@H]2N)CCCC1.
What is the InChIKey of (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine?
The InChIKey is LNMAINKFAPXYIH-NXEZZACHSA-N. The full InChI is InChI=1S/C11H22N2O/c1-11(5-2-3-6-11)13-10-4-7-14-8-9(10)12/h9-10,13H,2-8,12H2,1H3/t9-,10-/m1/s1.
What are the key properties of (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine?
(3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine has a molecular weight of 198.31 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-N-(1-methylcyclopentyl)oxane-3,4-diamine is sourced from PubChem (CID 58381294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).