About 2-(4-methylphenyl)-1,3-oxazinane
2-(4-methylphenyl)-1,3-oxazinane (PubChem CID 583813) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3-oxazinane.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,3-oxazinane |
| PubChem CID | 583813 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-(4-methylphenyl)-1,3-oxazinane |
| SMILES | Cc1ccc(C2NCCCO2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-9-3-5-10(6-4-9)11-12-7-2-8-13-11/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | KVGWOWHXYIRJNY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylphenyl)-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,3-oxazinane?
The IUPAC name of 2-(4-methylphenyl)-1,3-oxazinane (CID 583813) is 2-(4-methylphenyl)-1,3-oxazinane.
What is the SMILES notation for 2-(4-methylphenyl)-1,3-oxazinane?
The canonical SMILES for 2-(4-methylphenyl)-1,3-oxazinane is Cc1ccc(C2NCCCO2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-1,3-oxazinane?
The InChIKey is KVGWOWHXYIRJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-9-3-5-10(6-4-9)11-12-7-2-8-13-11/h3-6,11-12H,2,7-8H2,1H3.
What are the key properties of 2-(4-methylphenyl)-1,3-oxazinane?
2-(4-methylphenyl)-1,3-oxazinane has a molecular weight of 177.25 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,3-oxazinane is sourced from PubChem (CID 583813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).