C8H5BrF2N2O3 — CID 58381574
N-(4-bromo-2-nitrophenyl)-2,2-difluoroacetamide (PubChem CID 58381574) has the molecular formula C8H5BrF2N2O3 and a molecular weight of 295.04 g/mol. Its IUPAC name is N-(4-bromo-2-nitrophenyl)-2,2-difluoroacetamide.
| Compound Name | N-(4-bromo-2-nitrophenyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 58381574 |
| Molecular Formula | C8H5BrF2N2O3 |
| Molecular Weight | 295.04 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | N-(4-bromo-2-nitrophenyl)-2,2-difluoroacetamide |
| SMILES | O=C(Nc1ccc(Br)cc1[N+](=O)[O-])C(F)F |
| InChI | InChI=1S/C8H5BrF2N2O3/c9-4-1-2-5(6(3-4)13(15)16)12-8(14)7(10)11/h1-3,7H,(H,12,14) |
| InChIKey | GAJUXZBOYWAIRM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.04 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|