C21H34O4S — CID 58381725
ethyl 2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]sulfonylbutanoate (PubChem CID 58381725) has the molecular formula C21H34O4S and a molecular weight of 382.57 g/mol. Its IUPAC name is ethyl 2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]sulfonylbutanoate.
| Compound Name | ethyl 2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]sulfonylbutanoate |
|---|---|
| PubChem CID | 58381725 |
| Molecular Formula | C21H34O4S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | ethyl 2-[(3Z,6Z,9Z,12Z)-pentadeca-3,6,9,12-tetraenyl]sulfonylbutanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCS(=O)(=O)C(CC)C(=O)OCC |
| InChI | InChI=1S/C21H34O4S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-26(23,24)20(5-2)21(22)25-6-3/h7-8,10-11,13-14,16-17,20H,4-6,9,12,15,18-19H2,1-3H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | OWCCUPVEQBPKMT-ZKWNWVNESA-N |
| XLogP | 4.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|