C16H13NO2S — CID 58381824
2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1-phenylpyrrole (PubChem CID 58381824) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1-phenylpyrrole.
| Compound Name | 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1-phenylpyrrole |
|---|---|
| PubChem CID | 58381824 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-1-phenylpyrrole |
| SMILES | c1ccc(-n2cccc2-c2scc3c2OCCO3)cc1 |
| InChI | InChI=1S/C16H13NO2S/c1-2-5-12(6-3-1)17-8-4-7-13(17)16-15-14(11-20-16)18-9-10-19-15/h1-8,11H,9-10H2 |
| InChIKey | LBLXJRJEFSYMBJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |