C27H23N5O5S — CID 58381978
2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]acetic acid (PubChem CID 58381978) has the molecular formula C27H23N5O5S and a molecular weight of 529.58 g/mol. Its IUPAC name is 2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 58381978 |
| Molecular Formula | C27H23N5O5S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]acetic acid |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1S(=O)(=O)c1ccc(C)cc1)cnn4C)cn2CC(=O)O |
| InChI | InChI=1S/C27H23N5O5S/c1-16-4-7-19(8-5-16)38(35,36)32-24(11-21-26-17(12-28-27(21)32)13-29-30(26)2)22-14-31(15-25(33)34)23-9-6-18(37-3)10-20(22)23/h4-14H,15H2,1-3H3,(H,33,34) |
| InChIKey | JIRSZGILPQINJX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |