C28H25N5O4S — CID 58381994
11-[5-methoxy-1-(oxiran-2-ylmethyl)indol-3-yl]-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58381994) has the molecular formula C28H25N5O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is 11-[5-methoxy-1-(oxiran-2-ylmethyl)indol-3-yl]-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 11-[5-methoxy-1-(oxiran-2-ylmethyl)indol-3-yl]-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58381994 |
| Molecular Formula | C28H25N5O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 11-[5-methoxy-1-(oxiran-2-ylmethyl)indol-3-yl]-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1S(=O)(=O)c1ccc(C)cc1)cnn4C)cn2CC1CO1 |
| InChI | InChI=1S/C28H25N5O4S/c1-17-4-7-21(8-5-17)38(34,35)33-26(11-23-27-18(12-29-28(23)33)13-30-31(27)2)24-15-32(14-20-16-37-20)25-9-6-19(36-3)10-22(24)25/h4-13,15,20H,14,16H2,1-3H3 |
| InChIKey | RTIJTDDMYOHDJW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|