C20H21N5O — CID 58382002
4-[[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]methyl]morpholine (PubChem CID 58382002) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]methyl]morpholine.
| Compound Name | 4-[[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 58382002 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-[[3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)phenyl]methyl]morpholine |
| SMILES | Cn1[nH]cc2cnc3nc(-c4cccc(CN5CCOCC5)c4)cc3c21 |
| InChI | InChI=1S/C20H21N5O/c1-24-19-16(12-22-24)11-21-20-17(19)10-18(23-20)15-4-2-3-14(9-15)13-25-5-7-26-8-6-25/h2-4,9-12,22H,5-8,13H2,1H3 |
| InChIKey | KUIOWPNNYHYCLA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |