C28H36N5O5P — CID 58382025
ditert-butyl [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl phosphate (PubChem CID 58382025) has the molecular formula C28H36N5O5P and a molecular weight of 553.60 g/mol. Its IUPAC name is ditert-butyl [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl phosphate.
| Compound Name | ditert-butyl [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl phosphate |
|---|---|
| PubChem CID | 58382025 |
| Molecular Formula | C28H36N5O5P |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | ditert-butyl [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl phosphate |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1COP(=O)(OC(C)(C)C)OC(C)(C)C)cnn4C)cn2C |
| InChI | InChI=1S/C28H36N5O5P/c1-27(2,3)37-39(34,38-28(4,5)6)36-17-33-24(13-21-25-18(14-29-26(21)33)15-30-32(25)8)22-16-31(7)23-11-10-19(35-9)12-20(22)23/h10-16H,17H2,1-9H3 |
| InChIKey | OYVBDWISHUUDSD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|