C25H22N6O3S — CID 58382046
11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58382046) has the molecular formula C25H22N6O3S and a molecular weight of 486.56 g/mol. Its IUPAC name is 11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58382046 |
| Molecular Formula | C25H22N6O3S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 11-(5-methoxy-1-methylindazol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1S(=O)(=O)c1ccc(C)cc1)cnn4C)nn2C |
| InChI | InChI=1S/C25H22N6O3S/c1-15-5-8-18(9-6-15)35(32,33)31-22(12-20-24-16(13-26-25(20)31)14-27-30(24)3)23-19-11-17(34-4)7-10-21(19)29(2)28-23/h5-14H,1-4H3 |
| InChIKey | PLDLCKHMSAQCNA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 96.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |