C23H25N5O — CID 58382047
4-(12-cyclohexyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-N,N-dimethylbenzamide (PubChem CID 58382047) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-(12-cyclohexyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-N,N-dimethylbenzamide.
| Compound Name | 4-(12-cyclohexyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 58382047 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-(12-cyclohexyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2nc(C3CCCCC3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C23H25N5O/c1-27(2)23(29)17-10-8-15(9-11-17)20-19-14-25-21-18(12-13-24-21)28(19)22(26-20)16-6-4-3-5-7-16/h8-14,16,24H,3-7H2,1-2H3 |
| InChIKey | OAVYRHFAHZHTLX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |