C24H31N5O3Si — CID 58382089
trimethyl-[2-[[3-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane (PubChem CID 58382089) has the molecular formula C24H31N5O3Si and a molecular weight of 465.63 g/mol. Its IUPAC name is trimethyl-[2-[[3-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 58382089 |
| Molecular Formula | C24H31N5O3Si |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | trimethyl-[2-[[3-methyl-4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
| SMILES | Cc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc3nncn3c12 |
| InChI | InChI=1S/C24H31N5O3Si/c1-17-21(18-6-8-19(9-7-18)24(2)31-10-11-32-24)29(16-30-12-13-33(3,4)5)23-22(17)28-15-26-27-20(28)14-25-23/h6-9,14-15H,10-13,16H2,1-5H3 |
| InChIKey | KIRPEILMJJYMMN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|