C25H21N5O3S — CID 58382108
11-(5-methoxy-1H-indol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58382108) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is 11-(5-methoxy-1H-indol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 11-(5-methoxy-1H-indol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58382108 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 11-(5-methoxy-1H-indol-3-yl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | COc1ccc2[nH]cc(-c3cc4c5c(cnc4n3S(=O)(=O)c3ccc(C)cc3)cnn5C)c2c1 |
| InChI | InChI=1S/C25H21N5O3S/c1-15-4-7-18(8-5-15)34(31,32)30-23(21-14-26-22-9-6-17(33-3)10-19(21)22)11-20-24-16(12-27-25(20)30)13-28-29(24)2/h4-14,26H,1-3H3 |
| InChIKey | JYIXHXQZLGCDFC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |