C24H26N6O2 — CID 58382156
N-(3-hydroxy-2,2-dimethylpropyl)-1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indole-5-carboxamide (PubChem CID 58382156) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indole-5-carboxamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indole-5-carboxamide |
|---|---|
| PubChem CID | 58382156 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indole-5-carboxamide |
| SMILES | Cn1cc(-c2cc3c(ncc4c[nH]n(C)c43)n2)c2cc(C(=O)NCC(C)(C)CO)ccc21 |
| InChI | InChI=1S/C24H26N6O2/c1-24(2,13-31)12-26-23(32)14-5-6-20-16(7-14)18(11-29(20)3)19-8-17-21-15(10-27-30(21)4)9-25-22(17)28-19/h5-11,27,31H,12-13H2,1-4H3,(H,26,32) |
| InChIKey | JXOYBMQSGIUCID-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |