C20H21N5O2S — CID 58382167
10-(4-methylsulfonylphenyl)-12-[(3S)-piperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58382167) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 10-(4-methylsulfonylphenyl)-12-[(3S)-piperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 10-(4-methylsulfonylphenyl)-12-[(3S)-piperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382167 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 10-(4-methylsulfonylphenyl)-12-[(3S)-piperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CS(=O)(=O)c1ccc(-c2nc([C@H]3CCCNC3)n3c2cnc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C20H21N5O2S/c1-28(26,27)15-6-4-13(5-7-15)18-17-12-23-19-16(8-10-22-19)25(17)20(24-18)14-3-2-9-21-11-14/h4-8,10,12,14,21-22H,2-3,9,11H2,1H3/t14-/m0/s1 |
| InChIKey | ZVKPIPIVARQDAP-AWEZNQCLSA-N |
| XLogP | 2.75 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |