C16H14N4O — CID 58382180
4-(4-methoxyphenyl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58382180) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 4-(4-methoxyphenyl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382180 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COc1ccc(-c2cc3c(ncc4cnc(C)n43)[nH]2)cc1 |
| InChI | InChI=1S/C16H14N4O/c1-10-17-8-12-9-18-16-15(20(10)12)7-14(19-16)11-3-5-13(21-2)6-4-11/h3-9,19H,1-2H3 |
| InChIKey | MINLOXXEBPIIER-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |