C39H31N5O5S — CID 58382221
2-[[2-[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 58382221) has the molecular formula C39H31N5O5S and a molecular weight of 681.77 g/mol. Its IUPAC name is 2-[[2-[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58382221 |
| Molecular Formula | C39H31N5O5S |
| Molecular Weight | 681.77 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | 2-[[2-[10-[4-(2-hydroxypropan-2-yl)phenyl]-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2c(-c4ccc(C(C)(C)O)cc4)nc(-c4ccccc4CN4C(=O)c5ccccc5C4=O)n23)cc1 |
| InChI | InChI=1S/C39H31N5O5S/c1-24-12-18-28(19-13-24)50(48,49)43-21-20-32-36(43)40-22-33-34(25-14-16-27(17-15-25)39(2,3)47)41-35(44(32)33)29-9-5-4-8-26(29)23-42-37(45)30-10-6-7-11-31(30)38(42)46/h4-22,47H,23H2,1-3H3 |
| InChIKey | XWMWUGJGRHKVOJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.77 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|