C21H19N5O3S — CID 58382236
1-[1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indol-5-yl]-2-methylsulfonylethanone (PubChem CID 58382236) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-[1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indol-5-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indol-5-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 58382236 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[1-methyl-3-(3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-11-yl)indol-5-yl]-2-methylsulfonylethanone |
| SMILES | Cn1cc(-c2cc3c(ncc4c[nH]n(C)c43)n2)c2cc(C(=O)CS(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H19N5O3S/c1-25-10-16(14-6-12(4-5-18(14)25)19(27)11-30(3,28)29)17-7-15-20-13(9-23-26(20)2)8-22-21(15)24-17/h4-10,23H,11H2,1-3H3 |
| InChIKey | PXPGMDBELFDDNZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |