C33H39N5O4SSi — CID 58382240
tert-butyl-[2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethoxy]-dimethylsilane (PubChem CID 58382240) has the molecular formula C33H39N5O4SSi and a molecular weight of 629.86 g/mol. Its IUPAC name is tert-butyl-[2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58382240 |
| Molecular Formula | C33H39N5O4SSi |
| Molecular Weight | 629.86 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | tert-butyl-[2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethoxy]-dimethylsilane |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1S(=O)(=O)c1ccc(C)cc1)cnn4C)cn2CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H39N5O4SSi/c1-22-9-12-25(13-10-22)43(39,40)38-30(18-27-31-23(19-34-32(27)38)20-35-36(31)5)28-21-37(15-16-42-44(7,8)33(2,3)4)29-14-11-24(41-6)17-26(28)29/h9-14,17-21H,15-16H2,1-8H3 |
| InChIKey | HDBRCSOVCIDFBA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|