C27H38N4O4Si — CID 58382339
N-[[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]methyl]acetamide (PubChem CID 58382339) has the molecular formula C27H38N4O4Si and a molecular weight of 510.71 g/mol. Its IUPAC name is N-[[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]methyl]acetamide.
| Compound Name | N-[[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 58382339 |
| Molecular Formula | C27H38N4O4Si |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | N-[[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]methyl]acetamide |
| SMILES | CCc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc(CNC(C)=O)nc12 |
| InChI | InChI=1S/C27H38N4O4Si/c1-7-23-24-26(29-17-22(30-24)16-28-19(2)32)31(18-33-14-15-36(4,5)6)25(23)20-8-10-21(11-9-20)27(3)34-12-13-35-27/h8-11,17H,7,12-16,18H2,1-6H3,(H,28,32) |
| InChIKey | DVXOHHHUZWACOP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|