C27H25N5O4S — CID 58382350
2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethanol (PubChem CID 58382350) has the molecular formula C27H25N5O4S and a molecular weight of 515.60 g/mol. Its IUPAC name is 2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethanol.
| Compound Name | 2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethanol |
|---|---|
| PubChem CID | 58382350 |
| Molecular Formula | C27H25N5O4S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 2-[5-methoxy-3-[3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]indol-1-yl]ethanol |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1S(=O)(=O)c1ccc(C)cc1)cnn4C)cn2CCO |
| InChI | InChI=1S/C27H25N5O4S/c1-17-4-7-20(8-5-17)37(34,35)32-25(13-22-26-18(14-28-27(22)32)15-29-30(26)2)23-16-31(10-11-33)24-9-6-19(36-3)12-21(23)24/h4-9,12-16,33H,10-11H2,1-3H3 |
| InChIKey | ONDHYFSFLOZUOY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |