C31H44N4O5Si — CID 58382377
tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(2-methylprop-2-enyl)carbamate (PubChem CID 58382377) has the molecular formula C31H44N4O5Si and a molecular weight of 580.80 g/mol. Its IUPAC name is tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(2-methylprop-2-enyl)carbamate.
| Compound Name | tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(2-methylprop-2-enyl)carbamate |
|---|---|
| PubChem CID | 58382377 |
| Molecular Formula | C31H44N4O5Si |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | tert-butyl N-[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-N-(2-methylprop-2-enyl)carbamate |
| SMILES | C=C(C)CN(C(=O)OC(C)(C)C)c1cnc2c(cc(-c3ccc(C4(C)OCCO4)cc3)n2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C31H44N4O5Si/c1-22(2)20-34(29(36)40-30(3,4)5)27-19-32-28-25(33-27)18-26(35(28)21-37-16-17-41(7,8)9)23-10-12-24(13-11-23)31(6)38-14-15-39-31/h10-13,18-19H,1,14-17,20-21H2,2-9H3 |
| InChIKey | NAQSRJKXQBHCIU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|