C19H17N5 — CID 58382481
11-(1,5-dimethylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene (PubChem CID 58382481) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is 11-(1,5-dimethylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene.
| Compound Name | 11-(1,5-dimethylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382481 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 11-(1,5-dimethylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaene |
| SMILES | Cc1ccc2c(c1)c(-c1cc3c(ncc4c[nH]n(C)c43)n1)cn2C |
| InChI | InChI=1S/C19H17N5/c1-11-4-5-17-13(6-11)15(10-23(17)2)16-7-14-18-12(9-21-24(18)3)8-20-19(14)22-16/h4-10,21H,1-3H3 |
| InChIKey | OCNLCUYCIHKZGD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |