C23H23N5 — CID 58382489
12-cyclohexyl-10-(1-methylindol-5-yl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58382489) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 12-cyclohexyl-10-(1-methylindol-5-yl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-cyclohexyl-10-(1-methylindol-5-yl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382489 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 12-cyclohexyl-10-(1-methylindol-5-yl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cn1ccc2cc(-c3nc(C4CCCCC4)n4c3cnc3[nH]ccc34)ccc21 |
| InChI | InChI=1S/C23H23N5/c1-27-12-10-16-13-17(7-8-18(16)27)21-20-14-25-22-19(9-11-24-22)28(20)23(26-21)15-5-3-2-4-6-15/h7-15,24H,2-6H2,1H3 |
| InChIKey | BZOIKYOSLOWIIX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |