About 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine
9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine (PubChem CID 58382607) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine.
Molecular Properties
| Compound Name | 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine |
| PubChem CID | 58382607 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine |
| SMILES | CC1(N)CCC2(CC1)OCCCO2 |
| InChI | InChI=1S/C10H19NO2/c1-9(11)3-5-10(6-4-9)12-7-2-8-13-10/h2-8,11H2,1H3 |
| InChIKey | LTPFQVSDUCOSPP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
The IUPAC name of 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine (CID 58382607) is 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine.
What is the SMILES notation for 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
The canonical SMILES for 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine is CC1(N)CCC2(CC1)OCCCO2.
What is the InChIKey of 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
The InChIKey is LTPFQVSDUCOSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-9(11)3-5-10(6-4-9)12-7-2-8-13-10/h2-8,11H2,1H3.
What are the key properties of 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine?
9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine has a molecular weight of 185.27 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-1,5-dioxaspiro[5.5]undecan-9-amine is sourced from PubChem (CID 58382607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).