C33H37B2N3O4 — CID 58382622
2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58382622) has the molecular formula C33H37B2N3O4 and a molecular weight of 561.30 g/mol. Its IUPAC name is 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58382622 |
| Molecular Formula | C33H37B2N3O4 |
| Molecular Weight | 561.30 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(B3OC(C)(C)C(C)(C)O3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C33H37B2N3O4/c1-30(2)31(3,4)40-34(39-30)25-19-24(20-26(21-25)35-41-32(5,6)33(7,8)42-35)29-37-27(22-15-11-9-12-16-22)36-28(38-29)23-17-13-10-14-18-23/h9-21H,1-8H3 |
| InChIKey | MJSGOSDSQQKTOM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|