About N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide
N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide (PubChem CID 58382948) has the molecular formula C23H25FN2O2S
and a molecular weight of 412.53 g/mol. Its IUPAC name is N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide |
| PubChem CID | 58382948 |
| Molecular Formula | C23H25FN2O2S |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1Sc2ccccc2-c2c1c1cccc(OC)c1n2CCF |
| InChI | InChI=1S/C23H25FN2O2S/c1-4-25(5-2)23(27)22-19-16-10-8-11-17(28-3)20(16)26(14-13-24)21(19)15-9-6-7-12-18(15)29-22/h6-12,22H,4-5,13-14H2,1-3H3 |
| InChIKey | CSWQEZJPOVECNM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The IUPAC name of N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide (CID 58382948) is N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide.
What is the SMILES notation for N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The canonical SMILES for N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide is CCN(CC)C(=O)C1Sc2ccccc2-c2c1c1cccc(OC)c1n2CCF.
What is the InChIKey of N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The InChIKey is CSWQEZJPOVECNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25FN2O2S/c1-4-25(5-2)23(27)22-19-16-10-8-11-17(28-3)20(16)26(14-13-24)21(19)15-9-6-7-12-18(15)29-22/h6-12,22H,4-5,13-14H2,1-3H3.
What are the key properties of N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide has a molecular weight of 412.53 g/mol, XLogP of 5.30, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-11-(2-fluoroethyl)-10-methoxy-6H-thiochromeno[4,3-b]indole-6-carboxamide is sourced from PubChem (CID 58382948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).