About 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide
8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide (PubChem CID 58382951) has the molecular formula C24H28N2O3S
and a molecular weight of 424.57 g/mol. Its IUPAC name is 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide.
Molecular Properties
| Compound Name | 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide |
| PubChem CID | 58382951 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide |
| SMILES | CCOc1ccc2c(c1)c1c(n2CCO)-c2ccccc2SC1C(=O)N(CC)CC |
| InChI | InChI=1S/C24H28N2O3S/c1-4-25(5-2)24(28)23-21-18-15-16(29-6-3)11-12-19(18)26(13-14-27)22(21)17-9-7-8-10-20(17)30-23/h7-12,15,23,27H,4-6,13-14H2,1-3H3 |
| InChIKey | FGPPXOOOKUTIME-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The IUPAC name of 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide (CID 58382951) is 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide.
What is the SMILES notation for 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The canonical SMILES for 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide is CCOc1ccc2c(c1)c1c(n2CCO)-c2ccccc2SC1C(=O)N(CC)CC.
What is the InChIKey of 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The InChIKey is FGPPXOOOKUTIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O3S/c1-4-25(5-2)24(28)23-21-18-15-16(29-6-3)11-12-19(18)26(13-14-27)22(21)17-9-7-8-10-20(17)30-23/h7-12,15,23,27H,4-6,13-14H2,1-3H3.
What are the key properties of 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide?
8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide has a molecular weight of 424.57 g/mol, XLogP of 4.71, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethoxy-N,N-diethyl-11-(2-hydroxyethyl)-6H-thiochromeno[4,3-b]indole-6-carboxamide is sourced from PubChem (CID 58382951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).