C33H25F8NO — CID 58383284
2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]pyridine (PubChem CID 58383284) has the molecular formula C33H25F8NO and a molecular weight of 603.55 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]pyridine.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]pyridine |
|---|---|
| PubChem CID | 58383284 |
| Molecular Formula | C33H25F8NO |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]pyridine |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C33H25F8NO/c1-2-3-18-4-6-19(7-5-18)21-9-11-30(42-17-21)20-8-10-24(25(34)12-20)22-13-26(35)31(27(36)14-22)33(40,41)43-23-15-28(37)32(39)29(38)16-23/h2-3,8-19H,4-7H2,1H3/b3-2+ |
| InChIKey | KTUSOLSLTSBJOD-NSCUHMNNSA-N |
| XLogP | 10.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|