C35H31F8NO — CID 58383346
2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine (PubChem CID 58383346) has the molecular formula C35H31F8NO and a molecular weight of 633.62 g/mol. Its IUPAC name is 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine.
| Compound Name | 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine |
|---|---|
| PubChem CID | 58383346 |
| Molecular Formula | C35H31F8NO |
| Molecular Weight | 633.62 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(4-pentylcyclohexyl)pyridine |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C35H31F8NO/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-13-32(44-19-22)24-16-28(37)33(29(38)17-24)35(42,43)45-25-11-12-26(27(36)18-25)23-14-30(39)34(41)31(40)15-23/h10-21H,2-9H2,1H3 |
| InChIKey | MJYXZKGHUJVQCR-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.62 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|