C33H34F7NO3 — CID 58383435
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)cyclohexyl]pyridine (PubChem CID 58383435) has the molecular formula C33H34F7NO3 and a molecular weight of 625.63 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)cyclohexyl]pyridine.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)cyclohexyl]pyridine |
|---|---|
| PubChem CID | 58383435 |
| Molecular Formula | C33H34F7NO3 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)cyclohexyl]pyridine |
| SMILES | CCCCCC1COC(C2CCC(c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)nc3)CC2)OC1 |
| InChI | InChI=1S/C33H34F7NO3/c1-2-3-4-5-19-17-42-32(43-18-19)21-8-6-20(7-9-21)22-10-11-29(41-16-22)23-12-25(34)30(26(35)13-23)33(39,40)44-24-14-27(36)31(38)28(37)15-24/h10-16,19-21,32H,2-9,17-18H2,1H3 |
| InChIKey | CPUFAPAGGRNZMZ-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|