C35H30F8N2O2 — CID 58383445
[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-[2-fluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]methanone (PubChem CID 58383445) has the molecular formula C35H30F8N2O2 and a molecular weight of 662.62 g/mol. Its IUPAC name is [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-[2-fluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]methanone.
| Compound Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-[2-fluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 58383445 |
| Molecular Formula | C35H30F8N2O2 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-[2-fluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]methanone |
| SMILES | CCCCCC1CCC(c2cnc(-c3ccc(C(=O)c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C35H30F8N2O2/c1-2-3-4-5-19-6-8-20(9-7-19)23-17-44-34(45-18-23)21-10-11-25(26(36)12-21)33(46)22-13-27(37)31(28(38)14-22)35(42,43)47-24-15-29(39)32(41)30(40)16-24/h10-20H,2-9H2,1H3 |
| InChIKey | WCPFHYHALAKHED-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|