C33H29F6NO3 — CID 58383475
5-[4-[difluoro-[2-fluoro-4-(5-pentyl-1,3-dioxan-2-yl)phenyl]methoxy]-2-fluorophenyl]-2-(3,4-difluorophenyl)pyridine (PubChem CID 58383475) has the molecular formula C33H29F6NO3 and a molecular weight of 601.59 g/mol. Its IUPAC name is 5-[4-[difluoro-[2-fluoro-4-(5-pentyl-1,3-dioxan-2-yl)phenyl]methoxy]-2-fluorophenyl]-2-(3,4-difluorophenyl)pyridine.
| Compound Name | 5-[4-[difluoro-[2-fluoro-4-(5-pentyl-1,3-dioxan-2-yl)phenyl]methoxy]-2-fluorophenyl]-2-(3,4-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 58383475 |
| Molecular Formula | C33H29F6NO3 |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | 5-[4-[difluoro-[2-fluoro-4-(5-pentyl-1,3-dioxan-2-yl)phenyl]methoxy]-2-fluorophenyl]-2-(3,4-difluorophenyl)pyridine |
| SMILES | CCCCCC1COC(c2ccc(C(F)(F)Oc3ccc(-c4ccc(-c5ccc(F)c(F)c5)nc4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C33H29F6NO3/c1-2-3-4-5-20-18-41-32(42-19-20)22-6-11-26(29(36)15-22)33(38,39)43-24-9-10-25(28(35)16-24)23-8-13-31(40-17-23)21-7-12-27(34)30(37)14-21/h6-17,20,32H,2-5,18-19H2,1H3 |
| InChIKey | JSOAREHDXASDPR-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|