C35H24ClF8NO — CID 58383528
2-[4-[4-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-3-fluorophenyl]-5-pentylpyridine (PubChem CID 58383528) has the molecular formula C35H24ClF8NO and a molecular weight of 662.02 g/mol. Its IUPAC name is 2-[4-[4-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-3-fluorophenyl]-5-pentylpyridine.
| Compound Name | 2-[4-[4-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-3-fluorophenyl]-5-pentylpyridine |
|---|---|
| PubChem CID | 58383528 |
| Molecular Formula | C35H24ClF8NO |
| Molecular Weight | 662.02 g/mol |
| Exact Mass | 661.14 |
| IUPAC Name | 2-[4-[4-[4-[(4-chloro-3,5-difluorophenoxy)-difluoromethyl]-3,5-difluorophenyl]-3-fluorophenyl]-3-fluorophenyl]-5-pentylpyridine |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(Cl)c(F)c5)c(F)c4)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C35H24ClF8NO/c1-2-3-4-5-19-6-11-32(45-18-19)21-8-10-24(27(38)13-21)20-7-9-25(26(37)12-20)22-14-28(39)33(29(40)15-22)35(43,44)46-23-16-30(41)34(36)31(42)17-23/h6-18H,2-5H2,1H3 |
| InChIKey | SYOYHEOFTPJLGE-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.02 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|