C33H27F8NO3 — CID 58383607
2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyridine (PubChem CID 58383607) has the molecular formula C33H27F8NO3 and a molecular weight of 637.57 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyridine.
| Compound Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyridine |
|---|---|
| PubChem CID | 58383607 |
| Molecular Formula | C33H27F8NO3 |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | 2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyridine |
| SMILES | CCCCCC1COC(c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C33H27F8NO3/c1-2-3-4-5-18-16-43-32(44-17-18)20-7-9-29(42-15-20)19-6-8-23(24(34)10-19)21-11-25(35)30(26(36)12-21)33(40,41)45-22-13-27(37)31(39)28(38)14-22/h6-15,18,32H,2-5,16-17H2,1H3 |
| InChIKey | VMHIWHUWACFMCD-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|