C35H29F9N2O2 — CID 58383657
[4-[[2,6-difluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]-difluoromethoxy]-2,6-difluorophenyl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 58383657) has the molecular formula C35H29F9N2O2 and a molecular weight of 680.61 g/mol. Its IUPAC name is [4-[[2,6-difluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]-difluoromethoxy]-2,6-difluorophenyl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [4-[[2,6-difluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]-difluoromethoxy]-2,6-difluorophenyl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 58383657 |
| Molecular Formula | C35H29F9N2O2 |
| Molecular Weight | 680.61 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | [4-[[2,6-difluoro-4-[5-(4-pentylcyclohexyl)pyrimidin-2-yl]phenyl]-difluoromethoxy]-2,6-difluorophenyl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | CCCCCC1CCC(c2cnc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(C(=O)c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C35H29F9N2O2/c1-2-3-4-5-18-6-8-19(9-7-18)22-16-45-34(46-17-22)21-12-26(38)31(27(39)13-21)35(43,44)48-23-14-24(36)30(25(37)15-23)33(47)20-10-28(40)32(42)29(41)11-20/h10-19H,2-9H2,1H3 |
| InChIKey | WBTVADRYRFGAQV-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.61 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|