C36H25F8NO3 — CID 58383688
[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(5-pentyl-2-pyridinyl)phenyl]benzoate (PubChem CID 58383688) has the molecular formula C36H25F8NO3 and a molecular weight of 671.58 g/mol. Its IUPAC name is [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(5-pentyl-2-pyridinyl)phenyl]benzoate.
| Compound Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(5-pentyl-2-pyridinyl)phenyl]benzoate |
|---|---|
| PubChem CID | 58383688 |
| Molecular Formula | C36H25F8NO3 |
| Molecular Weight | 671.58 g/mol |
| Exact Mass | 671.17 |
| IUPAC Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(5-pentyl-2-pyridinyl)phenyl]benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C(=O)Oc4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C36H25F8NO3/c1-2-3-4-5-20-6-13-32(45-19-20)22-9-7-21(8-10-22)23-11-12-26(27(37)14-23)35(46)47-24-15-28(38)33(29(39)16-24)36(43,44)48-25-17-30(40)34(42)31(41)18-25/h6-19H,2-5H2,1H3 |
| InChIKey | GVLDXYKSMYDDGY-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.58 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|