C36H31F8NO2 — CID 58383762
[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-[5-(4-pentylcyclohexyl)-2-pyridinyl]methanone (PubChem CID 58383762) has the molecular formula C36H31F8NO2 and a molecular weight of 661.63 g/mol. Its IUPAC name is [4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-[5-(4-pentylcyclohexyl)-2-pyridinyl]methanone.
| Compound Name | [4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-[5-(4-pentylcyclohexyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58383762 |
| Molecular Formula | C36H31F8NO2 |
| Molecular Weight | 661.63 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | [4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-[5-(4-pentylcyclohexyl)-2-pyridinyl]methanone |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C36H31F8NO2/c1-2-3-4-5-20-6-8-21(9-7-20)23-11-13-32(45-19-23)35(46)22-10-12-26(27(37)14-22)24-15-28(38)33(29(39)16-24)36(43,44)47-25-17-30(40)34(42)31(41)18-25/h10-21H,2-9H2,1H3 |
| InChIKey | FALPCKCTUHVYPR-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.63 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|